C27H34N2O3 — CID 19071570
N-[8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide (PubChem CID 19071570) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide.
| Compound Name | N-[8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 19071570 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | N-[8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]benzamide |
| SMILES | C=CCN1CCC2(c3cccc(OC)c3)CC(NC(=O)c3ccccc3)CCC2(OC)C1 |
| InChI | InChI=1S/C27H34N2O3/c1-4-16-29-17-15-26(22-11-8-12-24(18-22)31-2)19-23(13-14-27(26,20-29)32-3)28-25(30)21-9-6-5-7-10-21/h4-12,18,23H,1,13-17,19-20H2,2-3H3,(H,28,30) |
| InChIKey | VYQFIPUELPFULK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|