C29H36N2O4 — CID 70336012
N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 70336012) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 70336012 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@H](NC(=O)C=Cc3cccc(OC)c3)CC[C@]2(OC)C1 |
| InChI | InChI=1S/C29H36N2O4/c1-4-16-31-17-15-28(23-8-6-9-25(32)19-23)20-24(13-14-29(28,21-31)35-3)30-27(33)12-11-22-7-5-10-26(18-22)34-2/h4-12,18-19,24,32H,1,13-17,20-21H2,2-3H3,(H,30,33)/t24-,28+,29+/m1/s1 |
| InChIKey | IOZZCHKRVNWCKK-MHZHKKNFSA-N |
| XLogP | 4.30 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|