C32H40N2O5 — CID 22441171
[3-[2-(cyclopropylmethyl)-8a-methoxy-6-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 22441171) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is [3-[2-(cyclopropylmethyl)-8a-methoxy-6-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[2-(cyclopropylmethyl)-8a-methoxy-6-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 22441171 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | [3-[2-(cyclopropylmethyl)-8a-methoxy-6-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | COc1cccc(/C=C/C(=O)NC2CCC3(OC)CN(CC4CC4)CCC3(c3cccc(OC(C)=O)c3)C2)c1 |
| InChI | InChI=1S/C32H40N2O5/c1-23(35)39-29-9-5-7-26(19-29)31-16-17-34(21-25-10-11-25)22-32(31,38-3)15-14-27(20-31)33-30(36)13-12-24-6-4-8-28(18-24)37-2/h4-9,12-13,18-19,25,27H,10-11,14-17,20-22H2,1-3H3,(H,33,36)/b13-12+ |
| InChIKey | AZJFZVOXSSYHGY-OUKQBFOZSA-N |
| XLogP | 4.74 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|