C28H34N2O5 — CID 67668288
[3-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-6-[3-(furan-3-yl)prop-2-enoylamino]-8a-hydroxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 67668288) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is [3-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-6-[3-(furan-3-yl)prop-2-enoylamino]-8a-hydroxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-6-[3-(furan-3-yl)prop-2-enoylamino]-8a-hydroxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67668288 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | [3-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-6-[3-(furan-3-yl)prop-2-enoylamino]-8a-hydroxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc([C@@]23CCN(CC4CC4)C[C@@]2(O)CC[C@@H](NC(=O)C=Cc2ccoc2)C3)c1 |
| InChI | InChI=1S/C28H34N2O5/c1-20(31)35-25-4-2-3-23(15-25)27-12-13-30(17-21-5-6-21)19-28(27,33)11-9-24(16-27)29-26(32)8-7-22-10-14-34-18-22/h2-4,7-8,10,14-15,18,21,24,33H,5-6,9,11-13,16-17,19H2,1H3,(H,29,32)/t24-,27+,28+/m1/s1 |
| InChIKey | BJKHXBUTZSDSRZ-KGPYPHOUSA-N |
| XLogP | 3.67 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|