C31H38N2O6 — CID 70337471
[3-[8a-acetyloxy-6-[methyl(phenylmethoxycarbonyl)amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 70337471) has the molecular formula C31H38N2O6 and a molecular weight of 534.65 g/mol. Its IUPAC name is [3-[8a-acetyloxy-6-[methyl(phenylmethoxycarbonyl)amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[8a-acetyloxy-6-[methyl(phenylmethoxycarbonyl)amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 70337471 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | [3-[8a-acetyloxy-6-[methyl(phenylmethoxycarbonyl)amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC(C)=O)c3)CC(N(C)C(=O)OCc3ccccc3)CCC2(OC(C)=O)C1 |
| InChI | InChI=1S/C31H38N2O6/c1-5-17-33-18-16-30(26-12-9-13-28(19-26)38-23(2)34)20-27(14-15-31(30,22-33)39-24(3)35)32(4)29(36)37-21-25-10-7-6-8-11-25/h5-13,19,27H,1,14-18,20-22H2,2-4H3 |
| InChIKey | INNKIMQLUIBQLZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|