C28H36N2O4 — CID 70340388
benzyl N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylcarbamate (PubChem CID 70340388) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is benzyl N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylcarbamate.
| Compound Name | benzyl N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 70340388 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | benzyl N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylcarbamate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@H](N(C)C(=O)OCc3ccccc3)CC[C@]2(OC)C1 |
| InChI | InChI=1S/C28H36N2O4/c1-4-16-30-17-15-27(23-11-8-12-25(31)18-23)19-24(13-14-28(27,21-30)33-3)29(2)26(32)34-20-22-9-6-5-7-10-22/h4-12,18,24,31H,1,13-17,19-21H2,2-3H3/t24-,27+,28+/m1/s1 |
| InChIKey | NMUQVBZCRRFWLF-KGPYPHOUSA-N |
| XLogP | 4.73 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|