C30H35F3N2O4 — CID 70336940
(E)-N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-3-[3-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 70336940) has the molecular formula C30H35F3N2O4 and a molecular weight of 544.61 g/mol. Its IUPAC name is (E)-N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-3-[3-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-3-[3-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 70336940 |
| Molecular Formula | C30H35F3N2O4 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | (E)-N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-3-[3-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | C=CCN1CCC2(c3cccc(O)c3)CC(N(C)C(=O)/C=C/c3cccc(OC(F)(F)F)c3)CCC2(OC)C1 |
| InChI | InChI=1S/C30H35F3N2O4/c1-4-16-35-17-15-28(23-8-6-9-25(36)19-23)20-24(13-14-29(28,21-35)38-3)34(2)27(37)12-11-22-7-5-10-26(18-22)39-30(31,32)33/h4-12,18-19,24,36H,1,13-17,20-21H2,2-3H3/b12-11+ |
| InChIKey | YXLVJVUBSNESIV-VAWYXSNFSA-N |
| XLogP | 5.53 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|