C33H37F3N2O6 — CID 70340533
[3-[8a-acetyloxy-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 70340533) has the molecular formula C33H37F3N2O6 and a molecular weight of 614.66 g/mol. Its IUPAC name is [3-[8a-acetyloxy-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[8a-acetyloxy-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 70340533 |
| Molecular Formula | C33H37F3N2O6 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | [3-[8a-acetyloxy-6-[methyl-[(E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoyl]amino]-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CCC2(c3cccc(OC(C)=O)c3)CC(N(C)C(=O)/C=C/c3cccc(OC(F)(F)F)c3)CCC2(OC(C)=O)C1 |
| InChI | InChI=1S/C33H37F3N2O6/c1-5-17-38-18-16-31(26-9-7-10-28(20-26)42-23(2)39)21-27(14-15-32(31,22-38)43-24(3)40)37(4)30(41)13-12-25-8-6-11-29(19-25)44-33(34,35)36/h5-13,19-20,27H,1,14-18,21-22H2,2-4H3/b13-12+ |
| InChIKey | GKSRQDKBQLTKIN-OUKQBFOZSA-N |
| XLogP | 5.67 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|