C28H34Cl2N2O3 — CID 18662199
N-[(4aS,6S,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide (PubChem CID 18662199) has the molecular formula C28H34Cl2N2O3 and a molecular weight of 517.50 g/mol. Its IUPAC name is N-[(4aS,6S,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide.
| Compound Name | N-[(4aS,6S,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 18662199 |
| Molecular Formula | C28H34Cl2N2O3 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-[(4aS,6S,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@@H](N(C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@]2(OC)C1 |
| InChI | InChI=1S/C28H34Cl2N2O3/c1-4-13-32-14-12-27(21-6-5-7-23(33)17-21)18-22(10-11-28(27,19-32)35-3)31(2)26(34)16-20-8-9-24(29)25(30)15-20/h4-9,15,17,22,33H,1,10-14,16,18-19H2,2-3H3/t22-,27-,28-/m0/s1 |
| InChIKey | YOHHLTBCIVTJCY-FAQZDJIUSA-N |
| XLogP | 5.47 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|