C29H36Cl2N2O3 — CID 70339269
N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide (PubChem CID 70339269) has the molecular formula C29H36Cl2N2O3 and a molecular weight of 531.52 g/mol. Its IUPAC name is N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide.
| Compound Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 70339269 |
| Molecular Formula | C29H36Cl2N2O3 |
| Molecular Weight | 531.52 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
| SMILES | CO[C@]12CC[C@@H](N(C)C(=O)Cc3ccc(Cl)c(Cl)c3)C[C@]1(c1cccc(O)c1)CCN(CC1CC1)C2 |
| InChI | InChI=1S/C29H36Cl2N2O3/c1-32(27(35)15-21-8-9-25(30)26(31)14-21)23-10-11-29(36-2)19-33(18-20-6-7-20)13-12-28(29,17-23)22-4-3-5-24(34)16-22/h3-5,8-9,14,16,20,23,34H,6-7,10-13,15,17-19H2,1-2H3/t23-,28+,29+/m1/s1 |
| InChIKey | HPMWFTSOWMHTHB-MGONOCMRSA-N |
| XLogP | 5.69 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |