C32H38N2O3 — CID 70336383
N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide (PubChem CID 70336383) has the molecular formula C32H38N2O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide.
| Compound Name | N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 70336383 |
| Molecular Formula | C32H38N2O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide |
| SMILES | COC12CCC(N(C)C(=O)c3ccc4ccccc4c3)CC1(c1cccc(O)c1)CCN(CC1CC1)C2 |
| InChI | InChI=1S/C32H38N2O3/c1-33(30(36)26-13-12-24-6-3-4-7-25(24)18-26)28-14-15-32(37-2)22-34(21-23-10-11-23)17-16-31(32,20-28)27-8-5-9-29(35)19-27/h3-9,12-13,18-19,23,28,35H,10-11,14-17,20-22H2,1-2H3 |
| InChIKey | LFNRDUJALYOPLV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |