C33H40N2O3 — CID 70337565
N-[2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide (PubChem CID 70337565) has the molecular formula C33H40N2O3 and a molecular weight of 512.69 g/mol. Its IUPAC name is N-[2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide.
| Compound Name | N-[2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 70337565 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | N-[2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylnaphthalene-2-carboxamide |
| SMILES | COc1cccc(C23CCN(CC4CC4)CC2(OC)CCC(N(C)C(=O)c2ccc4ccccc4c2)C3)c1 |
| InChI | InChI=1S/C33H40N2O3/c1-34(31(36)27-14-13-25-7-4-5-8-26(25)19-27)29-15-16-33(38-3)23-35(22-24-11-12-24)18-17-32(33,21-29)28-9-6-10-30(20-28)37-2/h4-10,13-14,19-20,24,29H,11-12,15-18,21-23H2,1-3H3 |
| InChIKey | IPRZJYOATVEYHW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |