C26H34N2O3 — CID 70337930
N-[(6S)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylbenzamide (PubChem CID 70337930) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[(6S)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylbenzamide.
| Compound Name | N-[(6S)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 70337930 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-[(6S)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methylbenzamide |
| SMILES | COc1cccc(C23CCN(C)CC2(OC)CC[C@H](N(C)C(=O)c2ccccc2)C3)c1 |
| InChI | InChI=1S/C26H34N2O3/c1-27-16-15-25(21-11-8-12-23(17-21)30-3)18-22(13-14-26(25,19-27)31-4)28(2)24(29)20-9-6-5-7-10-20/h5-12,17,22H,13-16,18-19H2,1-4H3/t22-,25?,26?/m0/s1 |
| InChIKey | VUGJWCJBIODOLK-OIEGUCRUSA-N |
| XLogP | 3.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |