C27H34N2O4 — CID 18662617
[3-[(4aS,6S,8aR)-6-[benzoyl(methyl)amino]-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate (PubChem CID 18662617) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is [3-[(4aS,6S,8aR)-6-[benzoyl(methyl)amino]-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aS,6S,8aR)-6-[benzoyl(methyl)amino]-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 18662617 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | [3-[(4aS,6S,8aR)-6-[benzoyl(methyl)amino]-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenyl] acetate |
| SMILES | CO[C@]12CC[C@H](N(C)C(=O)c3ccccc3)C[C@]1(c1cccc(OC(C)=O)c1)CCN(C)C2 |
| InChI | InChI=1S/C27H34N2O4/c1-20(30)33-24-12-8-11-22(17-24)26-15-16-28(2)19-27(26,32-4)14-13-23(18-26)29(3)25(31)21-9-6-5-7-10-21/h5-12,17,23H,13-16,18-19H2,1-4H3/t23-,26-,27-/m0/s1 |
| InChIKey | WXZPSYCALXYMNZ-YGPDHOBYSA-N |
| XLogP | 3.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|