C34H48N2O3 — CID 70340329
N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-6-phenylhexanamide (PubChem CID 70340329) has the molecular formula C34H48N2O3 and a molecular weight of 532.77 g/mol. Its IUPAC name is N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-6-phenylhexanamide.
| Compound Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 70340329 |
| Molecular Formula | C34H48N2O3 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.37 |
| IUPAC Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-8a-methoxy-4a-(3-methoxyphenyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-methyl-6-phenylhexanamide |
| SMILES | COc1cccc([C@@]23CCN(CC4CC4)C[C@@]2(OC)CC[C@@H](N(C)C(=O)CCCCCc2ccccc2)C3)c1 |
| InChI | InChI=1S/C34H48N2O3/c1-35(32(37)16-9-5-8-13-27-11-6-4-7-12-27)30-19-20-34(39-3)26-36(25-28-17-18-28)22-21-33(34,24-30)29-14-10-15-31(23-29)38-2/h4,6-7,10-12,14-15,23,28,30H,5,8-9,13,16-22,24-26H2,1-3H3/t30-,33+,34+/m1/s1 |
| InChIKey | CITWTADMBICERF-RDKKHIPBSA-N |
| XLogP | 6.25 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|