C36H52N2O3 — CID 70338300
N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide (PubChem CID 70338300) has the molecular formula C36H52N2O3 and a molecular weight of 560.82 g/mol. Its IUPAC name is N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide.
| Compound Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 70338300 |
| Molecular Formula | C36H52N2O3 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.40 |
| IUPAC Name | N-[(4aS,6R,8aR)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8a-methoxy-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide |
| SMILES | CO[C@]12CC[C@@H](N(CC(C)C)C(=O)CCCCCc3ccccc3)C[C@]1(c1cccc(O)c1)CCN(CC1CC1)C2 |
| InChI | InChI=1S/C36H52N2O3/c1-28(2)25-38(34(40)16-9-5-8-13-29-11-6-4-7-12-29)32-19-20-36(41-3)27-37(26-30-17-18-30)22-21-35(36,24-32)31-14-10-15-33(39)23-31/h4,6-7,10-12,14-15,23,28,30,32,39H,5,8-9,13,16-22,24-27H2,1-3H3/t32-,35+,36+/m1/s1 |
| InChIKey | ITTSYVJMDFVCFJ-GRGGVALCSA-N |
| XLogP | 6.97 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|