C33H48N2O3 — CID 70340221
N-[(4aS,6S,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide (PubChem CID 70340221) has the molecular formula C33H48N2O3 and a molecular weight of 520.76 g/mol. Its IUPAC name is N-[(4aS,6S,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide.
| Compound Name | N-[(4aS,6S,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 70340221 |
| Molecular Formula | C33H48N2O3 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | N-[(4aS,6S,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide |
| SMILES | CO[C@]12CC[C@H](N(CC(C)C)C(=O)CCCCCc3ccccc3)C[C@]1(c1cccc(O)c1)CCN(C)C2 |
| InChI | InChI=1S/C33H48N2O3/c1-26(2)24-35(31(37)17-10-6-9-14-27-12-7-5-8-13-27)29-18-19-33(38-4)25-34(3)21-20-32(33,23-29)28-15-11-16-30(36)22-28/h5,7-8,11-13,15-16,22,26,29,36H,6,9-10,14,17-21,23-25H2,1-4H3/t29-,32-,33-/m0/s1 |
| InChIKey | XAIGRKYCBZZQCF-LENAEUCASA-N |
| XLogP | 6.19 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|