C30H40N2O3 — CID 18662180
N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)benzamide (PubChem CID 18662180) has the molecular formula C30H40N2O3 and a molecular weight of 476.66 g/mol. Its IUPAC name is N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)benzamide.
| Compound Name | N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 18662180 |
| Molecular Formula | C30H40N2O3 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | N-[(4aS,6R,8aR)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)benzamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@H](N(CC(C)C)C(=O)c3ccccc3)CC[C@]2(OC)C1 |
| InChI | InChI=1S/C30H40N2O3/c1-5-17-31-18-16-29(25-12-9-13-27(33)19-25)20-26(14-15-30(29,22-31)35-4)32(21-23(2)3)28(34)24-10-7-6-8-11-24/h5-13,19,23,26,33H,1,14-18,20-22H2,2-4H3/t26-,29+,30+/m1/s1 |
| InChIKey | AVZZVJOMEXRESQ-POLDFPFKSA-N |
| XLogP | 5.26 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|