C36H52N2O3 — CID 70339321
N-[(4aS,6S,8aR)-8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide (PubChem CID 70339321) has the molecular formula C36H52N2O3 and a molecular weight of 560.82 g/mol. Its IUPAC name is N-[(4aS,6S,8aR)-8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide.
| Compound Name | N-[(4aS,6S,8aR)-8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 70339321 |
| Molecular Formula | C36H52N2O3 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.40 |
| IUPAC Name | N-[(4aS,6S,8aR)-8a-methoxy-4a-(3-methoxyphenyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-N-(2-methylpropyl)-6-phenylhexanamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC)c3)C[C@@H](N(CC(C)C)C(=O)CCCCCc3ccccc3)CC[C@]2(OC)C1 |
| InChI | InChI=1S/C36H52N2O3/c1-6-23-37-24-22-35(31-17-13-18-33(25-31)40-4)26-32(20-21-36(35,28-37)41-5)38(27-29(2)3)34(39)19-12-8-11-16-30-14-9-7-10-15-30/h6-7,9-10,13-15,17-18,25,29,32H,1,8,11-12,16,19-24,26-28H2,2-5H3/t32-,35-,36-/m0/s1 |
| InChIKey | PICFQDFDASMSPW-PUBVIUOISA-N |
| XLogP | 7.05 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|