C34H46N2O4 — CID 67728754
[3-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-6-[methyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 67728754) has the molecular formula C34H46N2O4 and a molecular weight of 546.75 g/mol. Its IUPAC name is [3-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-6-[methyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-6-[methyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67728754 |
| Molecular Formula | C34H46N2O4 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | [3-[(4aR,6S,8aS)-2-(cyclopropylmethyl)-8-hydroxy-6-[methyl(6-phenylhexanoyl)amino]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc([C@@]23CCN(CC4CC4)C[C@H]2C(O)C[C@@H](N(C)C(=O)CCCCCc2ccccc2)C3)c1 |
| InChI | InChI=1S/C34H46N2O4/c1-25(37)40-30-14-9-13-28(20-30)34-18-19-36(23-27-16-17-27)24-31(34)32(38)21-29(22-34)35(2)33(39)15-8-4-7-12-26-10-5-3-6-11-26/h3,5-6,9-11,13-14,20,27,29,31-32,38H,4,7-8,12,15-19,21-24H2,1-2H3/t29-,31+,32?,34+/m1/s1 |
| InChIKey | DAAPAYOKPUPYPF-BOMMIURESA-N |
| XLogP | 5.37 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|