C31H42N2O3 — CID 67728302
N-[(4aR,6R,8aS)-8-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide (PubChem CID 67728302) has the molecular formula C31H42N2O3 and a molecular weight of 490.69 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-8-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide.
| Compound Name | N-[(4aR,6R,8aS)-8-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 67728302 |
| Molecular Formula | C31H42N2O3 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | N-[(4aR,6R,8aS)-8-hydroxy-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@@H](N(C)C(=O)CCCCCc3ccccc3)CC(O)[C@@H]2C1 |
| InChI | InChI=1S/C31H42N2O3/c1-3-18-33-19-17-31(25-14-10-15-27(34)20-25)22-26(21-29(35)28(31)23-33)32(2)30(36)16-9-5-8-13-24-11-6-4-7-12-24/h3-4,6-7,10-12,14-15,20,26,28-29,34-35H,1,5,8-9,13,16-19,21-23H2,2H3/t26-,28-,29?,31-/m0/s1 |
| InChIKey | DKSCPAOCIGSPFB-PYHAKDNVSA-N |
| XLogP | 4.92 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|