C32H44N2O2 — CID 70337399
N-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide (PubChem CID 70337399) has the molecular formula C32H44N2O2 and a molecular weight of 488.72 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide.
| Compound Name | N-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide |
|---|---|
| PubChem CID | 70337399 |
| Molecular Formula | C32H44N2O2 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | N-[(4aR,6R,8aS)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-N-methyl-6-phenylhexanamide |
| SMILES | CN(C(=O)CCCCCc1ccccc1)[C@@H]1CC[C@@H]2CN(CC3CC3)CC[C@@]2(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C32H44N2O2/c1-33(31(36)14-7-3-6-11-25-9-4-2-5-10-25)29-18-17-28-24-34(23-26-15-16-26)20-19-32(28,22-29)27-12-8-13-30(35)21-27/h2,4-5,8-10,12-13,21,26,28-29,35H,3,6-7,11,14-20,22-24H2,1H3/t28-,29-,32+/m1/s1 |
| InChIKey | LMSDXZMGBVWBCS-PUCLRWMGSA-N |
| XLogP | 6.18 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|