C32H44N2O3 — CID 22441226
N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8-methoxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-6-phenylhexanamide (PubChem CID 22441226) has the molecular formula C32H44N2O3 and a molecular weight of 504.72 g/mol. Its IUPAC name is N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8-methoxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-6-phenylhexanamide.
| Compound Name | N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8-methoxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 22441226 |
| Molecular Formula | C32H44N2O3 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | N-[2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-8-methoxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-6-phenylhexanamide |
| SMILES | COC1CC(NC(=O)CCCCCc2ccccc2)CC2(c3cccc(O)c3)CCN(CC3CC3)CC12 |
| InChI | InChI=1S/C32H44N2O3/c1-37-30-20-27(33-31(36)14-7-3-6-11-24-9-4-2-5-10-24)21-32(26-12-8-13-28(35)19-26)17-18-34(23-29(30)32)22-25-15-16-25/h2,4-5,8-10,12-13,19,25,27,29-30,35H,3,6-7,11,14-18,20-23H2,1H3,(H,33,36) |
| InChIKey | VHQUZPUDIFSGIP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|