C32H45N2O2+ — CID 67671188
N-[(2R,4aR,6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-6-yl]-6-phenylhexanamide (PubChem CID 67671188) has the molecular formula C32H45N2O2+ and a molecular weight of 489.72 g/mol. Its IUPAC name is N-[(2R,4aR,6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-6-yl]-6-phenylhexanamide.
| Compound Name | N-[(2R,4aR,6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-6-yl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 67671188 |
| Molecular Formula | C32H45N2O2+ |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 489.35 |
| IUPAC Name | N-[(2R,4aR,6R)-2-(cyclopropylmethyl)-4a-(3-hydroxyphenyl)-2-methyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-6-yl]-6-phenylhexanamide |
| SMILES | C[N@+]1(CC2CC2)CC[C@@]2(c3cccc(O)c3)C[C@H](NC(=O)CCCCCc3ccccc3)CCC2C1 |
| InChI | InChI=1S/C32H44N2O2/c1-34(23-26-15-16-26)20-19-32(27-12-8-13-30(35)21-27)22-29(18-17-28(32)24-34)33-31(36)14-7-3-6-11-25-9-4-2-5-10-25/h2,4-5,8-10,12-13,21,26,28-29H,3,6-7,11,14-20,22-24H2,1H3,(H-,33,35,36)/p+1/t28?,29-,32+,34-/m1/s1 |
| InChIKey | SBJATRZHFBQWEE-APEWATBQSA-O |
| XLogP | 5.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|