C28H37Cl2N2O2+ — CID 67668524
N-[(2S,4aS,6R)-4a-(3-hydroxyphenyl)-2-methyl-2-(2-methylpropyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-6-yl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 67668524) has the molecular formula C28H37Cl2N2O2+ and a molecular weight of 504.52 g/mol. Its IUPAC name is N-[(2S,4aS,6R)-4a-(3-hydroxyphenyl)-2-methyl-2-(2-methylpropyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-6-yl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(2S,4aS,6R)-4a-(3-hydroxyphenyl)-2-methyl-2-(2-methylpropyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-6-yl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 67668524 |
| Molecular Formula | C28H37Cl2N2O2+ |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | N-[(2S,4aS,6R)-4a-(3-hydroxyphenyl)-2-methyl-2-(2-methylpropyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-6-yl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | CC(C)C[N@+]1(C)CC[C@]2(c3cccc(O)c3)C[C@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CCC2C1 |
| InChI | InChI=1S/C28H36Cl2N2O2/c1-19(2)17-32(3)12-11-28(21-5-4-6-24(33)15-21)16-23(9-8-22(28)18-32)31-27(34)14-20-7-10-25(29)26(30)13-20/h4-7,10,13,15,19,22-23H,8-9,11-12,14,16-18H2,1-3H3,(H-,31,33,34)/p+1/t22?,23-,28-,32+/m1/s1 |
| InChIKey | ZWCFLEFHBZTLAV-ZANFJLGYSA-O |
| XLogP | 5.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|