C28H32Cl2N2O3 — CID 18661832
[3-[(4aR,6R,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate (PubChem CID 18661832) has the molecular formula C28H32Cl2N2O3 and a molecular weight of 515.48 g/mol. Its IUPAC name is [3-[(4aR,6R,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate.
| Compound Name | [3-[(4aR,6R,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 18661832 |
| Molecular Formula | C28H32Cl2N2O3 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | [3-[(4aR,6R,8aS)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-yl]phenyl] acetate |
| SMILES | C=CCN1CC[C@@]2(c3cccc(OC(C)=O)c3)C[C@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C28H32Cl2N2O3/c1-3-12-32-13-11-28(21-5-4-6-24(16-21)35-19(2)33)17-23(9-8-22(28)18-32)31-27(34)15-20-7-10-25(29)26(30)14-20/h3-7,10,14,16,22-23H,1,8-9,11-13,15,17-18H2,2H3,(H,31,34)/t22-,23-,28+/m1/s1 |
| InChIKey | XCRFVRMRKYTYPN-MRJKTFCFSA-N |
| XLogP | 5.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|