C27H32Cl2N2O2 — CID 18661879
N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide (PubChem CID 18661879) has the molecular formula C27H32Cl2N2O2 and a molecular weight of 487.47 g/mol. Its IUPAC name is N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide.
| Compound Name | N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 18661879 |
| Molecular Formula | C27H32Cl2N2O2 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-[(4aR,6S,8aS)-4a-(3-hydroxyphenyl)-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-6-yl]-2-(3,4-dichlorophenyl)-N-methylacetamide |
| SMILES | C=CCN1CC[C@@]2(c3cccc(O)c3)C[C@@H](N(C)C(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C27H32Cl2N2O2/c1-3-12-31-13-11-27(20-5-4-6-23(32)16-20)17-22(9-8-21(27)18-31)30(2)26(33)15-19-7-10-24(28)25(29)14-19/h3-7,10,14,16,21-22,32H,1,8-9,11-13,15,17-18H2,2H3/t21-,22+,27+/m1/s1 |
| InChIKey | QQWXMFLDBNJLTK-VHSZZVNMSA-N |
| XLogP | 5.70 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|