C32H47N2O3+ — CID 67668223
N-[(2S,4aR,6S)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-2-(2-methylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide (PubChem CID 67668223) has the molecular formula C32H47N2O3+ and a molecular weight of 507.74 g/mol. Its IUPAC name is N-[(2S,4aR,6S)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-2-(2-methylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide.
| Compound Name | N-[(2S,4aR,6S)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-2-(2-methylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 67668223 |
| Molecular Formula | C32H47N2O3+ |
| Molecular Weight | 507.74 g/mol |
| Exact Mass | 507.36 |
| IUPAC Name | N-[(2S,4aR,6S)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-2-(2-methylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide |
| SMILES | CC(C)C[N@+]1(C)CC[C@]2(c3cccc(O)c3)C[C@@H](NC(=O)CCCCCc3ccccc3)CCC2(O)C1 |
| InChI | InChI=1S/C32H46N2O3/c1-25(2)23-34(3)20-19-31(27-14-10-15-29(35)21-27)22-28(17-18-32(31,37)24-34)33-30(36)16-9-5-8-13-26-11-6-4-7-12-26/h4,6-7,10-12,14-15,21,25,28,37H,5,8-9,13,16-20,22-24H2,1-3H3,(H-,33,35,36)/p+1/t28-,31+,32?,34-/m0/s1 |
| InChIKey | OJKDCIGUVREIHA-NJPQISIISA-O |
| XLogP | 5.34 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.74 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|