C37H47N3O2 — CID 11541920
N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide (PubChem CID 11541920) has the molecular formula C37H47N3O2 and a molecular weight of 565.80 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide.
| Compound Name | N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide |
|---|---|
| PubChem CID | 11541920 |
| Molecular Formula | C37H47N3O2 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.37 |
| IUPAC Name | N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-3-(3,4-dihydro-1H-isoquinolin-2-yl)propanamide |
| SMILES | C[C@]12CC[C@@H](NC(=O)CCN3CCc4ccccc4C3)C[C@@]1(c1cccc(O)c1)CCN(CCCc1ccccc1)C2 |
| InChI | InChI=1S/C37H47N3O2/c1-36-19-16-33(38-35(42)18-23-39-22-17-30-12-5-6-13-31(30)27-39)26-37(36,32-14-7-15-34(41)25-32)20-24-40(28-36)21-8-11-29-9-3-2-4-10-29/h2-7,9-10,12-15,25,33,41H,8,11,16-24,26-28H2,1H3,(H,38,42)/t33-,36-,37-/m1/s1 |
| InChIKey | NNPWUCZEYRNZSA-KUAYXKFLSA-N |
| XLogP | 6.09 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |