C35H40N2O2S — CID 73005499
N-[4a-(3-methoxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-1-benzothiophene-2-carboxamide (PubChem CID 73005499) has the molecular formula C35H40N2O2S and a molecular weight of 552.78 g/mol. Its IUPAC name is N-[4a-(3-methoxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4a-(3-methoxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 73005499 |
| Molecular Formula | C35H40N2O2S |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | N-[4a-(3-methoxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1cccc(C23CCN(CCCc4ccccc4)CC2(C)CCC(NC(=O)c2cc4ccccc4s2)C3)c1 |
| InChI | InChI=1S/C35H40N2O2S/c1-34-18-17-29(36-33(38)32-22-27-13-6-7-16-31(27)40-32)24-35(34,28-14-8-15-30(23-28)39-2)19-21-37(25-34)20-9-12-26-10-4-3-5-11-26/h3-8,10-11,13-16,22-23,29H,9,12,17-21,24-25H2,1-2H3,(H,36,38) |
| InChIKey | PRZZCTHNMSYVML-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |