C27H36N2O2 — CID 71217861
N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]acetamide (PubChem CID 71217861) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]acetamide.
| Compound Name | N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 71217861 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | N-[(4aR,6R,8aS)-4a-(3-hydroxyphenyl)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1CC[C@]2(C)CN(CCCc3ccccc3)CC[C@]2(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C27H36N2O2/c1-21(30)28-24-13-14-26(2)20-29(16-7-10-22-8-4-3-5-9-22)17-15-27(26,19-24)23-11-6-12-25(31)18-23/h3-6,8-9,11-12,18,24,31H,7,10,13-17,19-20H2,1-2H3,(H,28,30)/t24-,26-,27-/m1/s1 |
| InChIKey | PZPQEYFVMLRDHM-ZRJLEYOISA-N |
| XLogP | 4.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |