C24H28Cl2N2O3 — CID 70338252
N-[(6R)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 70338252) has the molecular formula C24H28Cl2N2O3 and a molecular weight of 463.41 g/mol. Its IUPAC name is N-[(6R)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(6R)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 70338252 |
| Molecular Formula | C24H28Cl2N2O3 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[(6R)-8a-hydroxy-4a-(3-hydroxyphenyl)-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | CN1CCC2(c3cccc(O)c3)C[C@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CCC2(O)C1 |
| InChI | InChI=1S/C24H28Cl2N2O3/c1-28-10-9-23(17-3-2-4-19(29)13-17)14-18(7-8-24(23,31)15-28)27-22(30)12-16-5-6-20(25)21(26)11-16/h2-6,11,13,18,29,31H,7-10,12,14-15H2,1H3,(H,27,30)/t18-,23?,24?/m1/s1 |
| InChIKey | OEBGFUPSKMISQU-WZFBRQLOSA-N |
| XLogP | 3.91 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |