C25H31Cl2N2O3+ — CID 67668434
N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 67668434) has the molecular formula C25H31Cl2N2O3+ and a molecular weight of 478.44 g/mol. Its IUPAC name is N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 67668434 |
| Molecular Formula | C25H31Cl2N2O3+ |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-hydroxyphenyl)-2,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | C[N+]1(C)CC[C@@]2(c3cccc(O)c3)C[C@@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CC[C@]2(O)C1 |
| InChI | InChI=1S/C25H30Cl2N2O3/c1-29(2)11-10-24(18-4-3-5-20(30)14-18)15-19(8-9-25(24,32)16-29)28-23(31)13-17-6-7-21(26)22(27)12-17/h3-7,12,14,19,32H,8-11,13,15-16H2,1-2H3,(H-,28,30,31)/p+1/t19-,24-,25-/m0/s1 |
| InChIKey | RVWBOUSJKRRXOF-LQGLAIQGSA-O |
| XLogP | 4.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|