C30H43N2O3+ — CID 67669980
N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-2,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide (PubChem CID 67669980) has the molecular formula C30H43N2O3+ and a molecular weight of 479.69 g/mol. Its IUPAC name is N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-2,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide.
| Compound Name | N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-2,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 67669980 |
| Molecular Formula | C30H43N2O3+ |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | N-[(4aS,6S,8aR)-8a-hydroxy-4a-(3-methoxyphenyl)-2,2-dimethyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]-6-phenylhexanamide |
| SMILES | COc1cccc([C@@]23CC[N+](C)(C)C[C@@]2(O)CC[C@H](NC(=O)CCCCCc2ccccc2)C3)c1 |
| InChI | InChI=1S/C30H42N2O3/c1-32(2)20-19-29(25-14-10-15-27(21-25)35-3)22-26(17-18-30(29,34)23-32)31-28(33)16-9-5-8-13-24-11-6-4-7-12-24/h4,6-7,10-12,14-15,21,26,34H,5,8-9,13,16-20,22-23H2,1-3H3/p+1/t26-,29-,30-/m0/s1 |
| InChIKey | FGKZDNSWFAYXNS-NSGJQZOKSA-O |
| XLogP | 4.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|