C30H39N2O5+ — CID 67669807
[(2R,4aS,6S)-4a-(3-methoxyphenyl)-2-methyl-6-(phenylmethoxycarbonylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate (PubChem CID 67669807) has the molecular formula C30H39N2O5+ and a molecular weight of 507.65 g/mol. Its IUPAC name is [(2R,4aS,6S)-4a-(3-methoxyphenyl)-2-methyl-6-(phenylmethoxycarbonylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate.
| Compound Name | [(2R,4aS,6S)-4a-(3-methoxyphenyl)-2-methyl-6-(phenylmethoxycarbonylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate |
|---|---|
| PubChem CID | 67669807 |
| Molecular Formula | C30H39N2O5+ |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | [(2R,4aS,6S)-4a-(3-methoxyphenyl)-2-methyl-6-(phenylmethoxycarbonylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-8a-yl] acetate |
| SMILES | C=CC[N@@+]1(C)CC[C@@]2(c3cccc(OC)c3)C[C@@H](NC(=O)OCc3ccccc3)CCC2(OC(C)=O)C1 |
| InChI | InChI=1S/C30H38N2O5/c1-5-17-32(3)18-16-29(25-12-9-13-27(19-25)35-4)20-26(14-15-30(29,22-32)37-23(2)33)31-28(34)36-21-24-10-7-6-8-11-24/h5-13,19,26H,1,14-18,20-22H2,2-4H3/p+1/t26-,29-,30?,32-/m0/s1 |
| InChIKey | ISAVNJGFPQOFJR-KORMDVCPSA-O |
| XLogP | 4.75 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|