C34H43Cl2N2O5+ — CID 67668436
[3-[(2S,4aR,6S)-8a-acetyloxy-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-(2-methylpropyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate (PubChem CID 67668436) has the molecular formula C34H43Cl2N2O5+ and a molecular weight of 630.63 g/mol. Its IUPAC name is [3-[(2S,4aR,6S)-8a-acetyloxy-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-(2-methylpropyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate.
| Compound Name | [3-[(2S,4aR,6S)-8a-acetyloxy-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-(2-methylpropyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67668436 |
| Molecular Formula | C34H43Cl2N2O5+ |
| Molecular Weight | 630.63 g/mol |
| Exact Mass | 629.25 |
| IUPAC Name | [3-[(2S,4aR,6S)-8a-acetyloxy-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-(2-methylpropyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate |
| SMILES | C=CC[N@@+]1(CC(C)C)CC[C@]2(c3cccc(OC(C)=O)c3)C[C@@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CCC2(OC(C)=O)C1 |
| InChI | InChI=1S/C34H42Cl2N2O5/c1-6-15-38(21-23(2)3)16-14-33(27-8-7-9-29(19-27)42-24(4)39)20-28(12-13-34(33,22-38)43-25(5)40)37-32(41)18-26-10-11-30(35)31(36)17-26/h6-11,17,19,23,28H,1,12-16,18,20-22H2,2-5H3/p+1/t28-,33+,34?,38-/m0/s1 |
| InChIKey | CSMXIDWAGYJBNQ-GHVLXAGPSA-O |
| XLogP | 6.43 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.63 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|