C33H43Cl2N2O4+ — CID 67670548
[3-[(2S,4aR,6S)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-8a-methoxy-2-(2-methylpropyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate (PubChem CID 67670548) has the molecular formula C33H43Cl2N2O4+ and a molecular weight of 602.62 g/mol. Its IUPAC name is [3-[(2S,4aR,6S)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-8a-methoxy-2-(2-methylpropyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate.
| Compound Name | [3-[(2S,4aR,6S)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-8a-methoxy-2-(2-methylpropyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67670548 |
| Molecular Formula | C33H43Cl2N2O4+ |
| Molecular Weight | 602.62 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | [3-[(2S,4aR,6S)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-8a-methoxy-2-(2-methylpropyl)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate |
| SMILES | C=CC[N@@+]1(CC(C)C)CC[C@]2(c3cccc(OC(C)=O)c3)C[C@@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CCC2(OC)C1 |
| InChI | InChI=1S/C33H42Cl2N2O4/c1-6-15-37(21-23(2)3)16-14-32(26-8-7-9-28(19-26)41-24(4)38)20-27(12-13-33(32,22-37)40-5)36-31(39)18-25-10-11-29(34)30(35)17-25/h6-11,17,19,23,27H,1,12-16,18,20-22H2,2-5H3/p+1/t27-,32+,33?,37-/m0/s1 |
| InChIKey | DYUYSLCMIYJKFA-GAAFHUDJSA-O |
| XLogP | 6.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|