C29H35Cl2N2O3+ — CID 67668144
[3-[(2R,4aR,6R)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-methyl-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-4a-yl]phenyl] acetate (PubChem CID 67668144) has the molecular formula C29H35Cl2N2O3+ and a molecular weight of 530.52 g/mol. Its IUPAC name is [3-[(2R,4aR,6R)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-methyl-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-4a-yl]phenyl] acetate.
| Compound Name | [3-[(2R,4aR,6R)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-methyl-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67668144 |
| Molecular Formula | C29H35Cl2N2O3+ |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | [3-[(2R,4aR,6R)-6-[[2-(3,4-dichlorophenyl)acetyl]amino]-2-methyl-2-prop-2-enyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-ium-4a-yl]phenyl] acetate |
| SMILES | C=CC[N@@+]1(C)CC[C@@]2(c3cccc(OC(C)=O)c3)C[C@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CCC2C1 |
| InChI | InChI=1S/C29H34Cl2N2O3/c1-4-13-33(3)14-12-29(22-6-5-7-25(17-22)36-20(2)34)18-24(10-9-23(29)19-33)32-28(35)16-21-8-11-26(30)27(31)15-21/h4-8,11,15,17,23-24H,1,9-10,12-14,16,18-19H2,2-3H3/p+1/t23?,24-,29+,33+/m1/s1 |
| InChIKey | PBJVNBPCIGRSJK-UVADFJAJSA-O |
| XLogP | 5.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|