C29H37N2O5+ — CID 67668448
[3-[(2R,4aS,6S)-8a-hydroxy-2-methyl-6-(phenylmethoxycarbonylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate (PubChem CID 67668448) has the molecular formula C29H37N2O5+ and a molecular weight of 493.62 g/mol. Its IUPAC name is [3-[(2R,4aS,6S)-8a-hydroxy-2-methyl-6-(phenylmethoxycarbonylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate.
| Compound Name | [3-[(2R,4aS,6S)-8a-hydroxy-2-methyl-6-(phenylmethoxycarbonylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate |
|---|---|
| PubChem CID | 67668448 |
| Molecular Formula | C29H37N2O5+ |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | [3-[(2R,4aS,6S)-8a-hydroxy-2-methyl-6-(phenylmethoxycarbonylamino)-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-4a-yl]phenyl] acetate |
| SMILES | C=CC[N@@+]1(C)CC[C@@]2(c3cccc(OC(C)=O)c3)C[C@@H](NC(=O)OCc3ccccc3)CCC2(O)C1 |
| InChI | InChI=1S/C29H36N2O5/c1-4-16-31(3)17-15-28(24-11-8-12-26(18-24)36-22(2)32)19-25(13-14-29(28,34)21-31)30-27(33)35-20-23-9-6-5-7-10-23/h4-12,18,25,34H,1,13-17,19-21H2,2-3H3/p+1/t25-,28-,29?,31-/m0/s1 |
| InChIKey | CHCDGOLZKWXVCX-GVWMCRQSSA-O |
| XLogP | 4.10 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|