C27H32Cl2N2O3 — CID 70340620
N-[(6R)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 70340620) has the molecular formula C27H32Cl2N2O3 and a molecular weight of 503.47 g/mol. Its IUPAC name is N-[(6R)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(6R)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 70340620 |
| Molecular Formula | C27H32Cl2N2O3 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-[(6R)-4a-(3-hydroxyphenyl)-8a-methoxy-2-prop-2-enyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | C=CCN1CCC2(c3cccc(O)c3)C[C@H](NC(=O)Cc3ccc(Cl)c(Cl)c3)CCC2(OC)C1 |
| InChI | InChI=1S/C27H32Cl2N2O3/c1-3-12-31-13-11-26(20-5-4-6-22(32)16-20)17-21(9-10-27(26,18-31)34-2)30-25(33)15-19-7-8-23(28)24(29)14-19/h3-8,14,16,21,32H,1,9-13,15,17-18H2,2H3,(H,30,33)/t21-,26?,27?/m1/s1 |
| InChIKey | FSERISHOQRATQF-QJYLRPAKSA-N |
| XLogP | 5.13 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|