C33H43N2O3+ — CID 67668431
N-[(2S,4aR,6R)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-2-(2-methylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]naphthalene-2-carboxamide (PubChem CID 67668431) has the molecular formula C33H43N2O3+ and a molecular weight of 515.72 g/mol. Its IUPAC name is N-[(2S,4aR,6R)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-2-(2-methylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(2S,4aR,6R)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-2-(2-methylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 67668431 |
| Molecular Formula | C33H43N2O3+ |
| Molecular Weight | 515.72 g/mol |
| Exact Mass | 515.33 |
| IUPAC Name | N-[(2S,4aR,6R)-8a-methoxy-4a-(3-methoxyphenyl)-2-methyl-2-(2-methylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-2-ium-6-yl]naphthalene-2-carboxamide |
| SMILES | COc1cccc([C@]23CC[N@@+](C)(CC(C)C)CC2(OC)CC[C@@H](NC(=O)c2ccc4ccccc4c2)C3)c1 |
| InChI | InChI=1S/C33H42N2O3/c1-24(2)22-35(3)18-17-32(28-11-8-12-30(20-28)37-4)21-29(15-16-33(32,23-35)38-5)34-31(36)27-14-13-25-9-6-7-10-26(25)19-27/h6-14,19-20,24,29H,15-18,21-23H2,1-5H3/p+1/t29-,32-,33?,35+/m1/s1 |
| InChIKey | ZSRDYXZPSXPYRB-OETVXTPUSA-O |
| XLogP | 5.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.72 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|