C23H31NO — CID 10382459
3-[(3R,4R)-3,4-dimethyl-1-(4-phenylbutyl)piperidin-4-yl]phenol (PubChem CID 10382459) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 3-[(3R,4R)-3,4-dimethyl-1-(4-phenylbutyl)piperidin-4-yl]phenol.
| Compound Name | 3-[(3R,4R)-3,4-dimethyl-1-(4-phenylbutyl)piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 10382459 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 3-[(3R,4R)-3,4-dimethyl-1-(4-phenylbutyl)piperidin-4-yl]phenol |
| SMILES | C[C@H]1CN(CCCCc2ccccc2)CC[C@@]1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C23H31NO/c1-19-18-24(15-7-6-11-20-9-4-3-5-10-20)16-14-23(19,2)21-12-8-13-22(25)17-21/h3-5,8-10,12-13,17,19,25H,6-7,11,14-16,18H2,1-2H3/t19-,23+/m0/s1 |
| InChIKey | KUHRKDRJGGTHKQ-WMZHIEFXSA-N |
| XLogP | 5.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|