C20H34ClNO — CID 18637251
3-[(3R,4S)-1-heptyl-3,4-dimethylpiperidin-4-yl]phenol;hydrochloride (PubChem CID 18637251) has the molecular formula C20H34ClNO and a molecular weight of 339.95 g/mol. Its IUPAC name is 3-[(3R,4S)-1-heptyl-3,4-dimethylpiperidin-4-yl]phenol;hydrochloride.
| Compound Name | 3-[(3R,4S)-1-heptyl-3,4-dimethylpiperidin-4-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 18637251 |
| Molecular Formula | C20H34ClNO |
| Molecular Weight | 339.95 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 3-[(3R,4S)-1-heptyl-3,4-dimethylpiperidin-4-yl]phenol;hydrochloride |
| SMILES | CCCCCCCN1CC[C@](C)(c2cccc(O)c2)[C@@H](C)C1.Cl |
| InChI | InChI=1S/C20H33NO.ClH/c1-4-5-6-7-8-13-21-14-12-20(3,17(2)16-21)18-10-9-11-19(22)15-18;/h9-11,15,17,22H,4-8,12-14,16H2,1-3H3;1H/t17-,20-;/m0./s1 |
| InChIKey | RDWVDQYSIPUIMO-ZHXLSBKVSA-N |
| XLogP | 5.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|