C20H34N2O — CID 18648607
3-[(3R,4S)-3,4-dimethyl-1-[3-(2-methylpropylamino)propyl]piperidin-4-yl]phenol (PubChem CID 18648607) has the molecular formula C20H34N2O and a molecular weight of 318.51 g/mol. Its IUPAC name is 3-[(3R,4S)-3,4-dimethyl-1-[3-(2-methylpropylamino)propyl]piperidin-4-yl]phenol.
| Compound Name | 3-[(3R,4S)-3,4-dimethyl-1-[3-(2-methylpropylamino)propyl]piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 18648607 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 3-[(3R,4S)-3,4-dimethyl-1-[3-(2-methylpropylamino)propyl]piperidin-4-yl]phenol |
| SMILES | CC(C)CNCCCN1CC[C@](C)(c2cccc(O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C20H34N2O/c1-16(2)14-21-10-6-11-22-12-9-20(4,17(3)15-22)18-7-5-8-19(23)13-18/h5,7-8,13,16-17,21,23H,6,9-12,14-15H2,1-4H3/t17-,20-/m0/s1 |
| InChIKey | FOXNJLFHJONKKO-PXNSSMCTSA-N |
| XLogP | 3.63 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|