C20H33NO — CID 18637244
3-[(3R,4S)-3,4-dimethyl-1-(5-methylhexyl)piperidin-4-yl]phenol (PubChem CID 18637244) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 3-[(3R,4S)-3,4-dimethyl-1-(5-methylhexyl)piperidin-4-yl]phenol.
| Compound Name | 3-[(3R,4S)-3,4-dimethyl-1-(5-methylhexyl)piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 18637244 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 3-[(3R,4S)-3,4-dimethyl-1-(5-methylhexyl)piperidin-4-yl]phenol |
| SMILES | CC(C)CCCCN1CC[C@](C)(c2cccc(O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C20H33NO/c1-16(2)8-5-6-12-21-13-11-20(4,17(3)15-21)18-9-7-10-19(22)14-18/h7,9-10,14,16-17,22H,5-6,8,11-13,15H2,1-4H3/t17-,20-/m0/s1 |
| InChIKey | NXCXMHMUINBTPC-PXNSSMCTSA-N |
| XLogP | 4.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|