C21H35NO — CID 22897408
2-ethyl-5-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol (PubChem CID 22897408) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 2-ethyl-5-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol.
| Compound Name | 2-ethyl-5-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol |
|---|---|
| PubChem CID | 22897408 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 2-ethyl-5-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol |
| SMILES | CCCCCCN1CC[C@](C)(c2ccc(CC)c(O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C21H35NO/c1-5-7-8-9-13-22-14-12-21(4,17(3)16-22)19-11-10-18(6-2)20(23)15-19/h10-11,15,17,23H,5-9,12-14,16H2,1-4H3/t17-,21-/m0/s1 |
| InChIKey | FXEAZNRULBEVGL-UWJYYQICSA-N |
| XLogP | 5.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|