C22H35N3 — CID 22966003
2-ethyl-6-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]-1H-benzimidazole (PubChem CID 22966003) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 2-ethyl-6-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-ethyl-6-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 22966003 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 2-ethyl-6-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]-1H-benzimidazole |
| SMILES | CCCCCCN1CC[C@](C)(c2ccc3nc(CC)[nH]c3c2)[C@@H](C)C1 |
| InChI | InChI=1S/C22H35N3/c1-5-7-8-9-13-25-14-12-22(4,17(3)16-25)18-10-11-19-20(15-18)24-21(6-2)23-19/h10-11,15,17H,5-9,12-14,16H2,1-4H3,(H,23,24)/t17-,22-/m0/s1 |
| InChIKey | QYZTYBCNFIXPFN-JTSKRJEESA-N |
| XLogP | 5.31 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|