C28H37N3O2S — CID 21355997
N-[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl]isoquinoline-5-sulfonamide (PubChem CID 21355997) has the molecular formula C28H37N3O2S and a molecular weight of 479.69 g/mol. Its IUPAC name is N-[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl]isoquinoline-5-sulfonamide.
| Compound Name | N-[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl]isoquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 21355997 |
| Molecular Formula | C28H37N3O2S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl]isoquinoline-5-sulfonamide |
| SMILES | CCCCCCN1CC[C@](C)(c2cccc(NS(=O)(=O)c3cccc4cnccc34)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C28H37N3O2S/c1-4-5-6-7-17-31-18-15-28(3,22(2)21-31)24-11-9-12-25(19-24)30-34(32,33)27-13-8-10-23-20-29-16-14-26(23)27/h8-14,16,19-20,22,30H,4-7,15,17-18,21H2,1-3H3/t22-,28-/m0/s1 |
| InChIKey | DRAUPOSBSBOYMI-DWACAAAGSA-N |
| XLogP | 6.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|