C18H29N3O2S — CID 22141270
3-hexyl-6-methyl-6-[3-(sulfamoylamino)phenyl]-3-azabicyclo[3.1.0]hexane (PubChem CID 22141270) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is 3-hexyl-6-methyl-6-[3-(sulfamoylamino)phenyl]-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-hexyl-6-methyl-6-[3-(sulfamoylamino)phenyl]-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 22141270 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 3-hexyl-6-methyl-6-[3-(sulfamoylamino)phenyl]-3-azabicyclo[3.1.0]hexane |
| SMILES | CCCCCCN1CC2C(C1)C2(C)c1cccc(NS(N)(=O)=O)c1 |
| InChI | InChI=1S/C18H29N3O2S/c1-3-4-5-6-10-21-12-16-17(13-21)18(16,2)14-8-7-9-15(11-14)20-24(19,22)23/h7-9,11,16-17,20H,3-6,10,12-13H2,1-2H3,(H2,19,22,23) |
| InChIKey | SLNRXMQYXWGJRX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|