C20H32N2O3S — CID 90769630
3-hexyl-6-[3-[1-hydroxy-2-(sulfinoamino)ethyl]phenyl]-6-methyl-3-azabicyclo[3.1.0]hexane (PubChem CID 90769630) has the molecular formula C20H32N2O3S and a molecular weight of 380.55 g/mol. Its IUPAC name is 3-hexyl-6-[3-[1-hydroxy-2-(sulfinoamino)ethyl]phenyl]-6-methyl-3-azabicyclo[3.1.0]hexane.
| Compound Name | 3-hexyl-6-[3-[1-hydroxy-2-(sulfinoamino)ethyl]phenyl]-6-methyl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 90769630 |
| Molecular Formula | C20H32N2O3S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-hexyl-6-[3-[1-hydroxy-2-(sulfinoamino)ethyl]phenyl]-6-methyl-3-azabicyclo[3.1.0]hexane |
| SMILES | CCCCCCN1CC2C(C1)C2(C)c1cccc(C(O)CNS(=O)O)c1 |
| InChI | InChI=1S/C20H32N2O3S/c1-3-4-5-6-10-22-13-17-18(14-22)20(17,2)16-9-7-8-15(11-16)19(23)12-21-26(24)25/h7-9,11,17-19,21,23H,3-6,10,12-14H2,1-2H3,(H,24,25) |
| InChIKey | XOLLNGXWLRAYNC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|